C22H26N2O6S — CID 43005274
(1-oxo-1-pyrrolidin-1-ylpropan-2-yl) 4-methoxy-3-[(4-methylphenyl)sulfamoyl]benzoate (PubChem CID 43005274) has the molecular formula C22H26N2O6S and a molecular weight of 446.53 g/mol. Its IUPAC name is (1-oxo-1-pyrrolidin-1-ylpropan-2-yl) 4-methoxy-3-[(4-methylphenyl)sulfamoyl]benzoate.
| Compound Name | (1-oxo-1-pyrrolidin-1-ylpropan-2-yl) 4-methoxy-3-[(4-methylphenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 43005274 |
| Molecular Formula | C22H26N2O6S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | (1-oxo-1-pyrrolidin-1-ylpropan-2-yl) 4-methoxy-3-[(4-methylphenyl)sulfamoyl]benzoate |
| SMILES | COc1ccc(C(=O)OC(C)C(=O)N2CCCC2)cc1S(=O)(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C22H26N2O6S/c1-15-6-9-18(10-7-15)23-31(27,28)20-14-17(8-11-19(20)29-3)22(26)30-16(2)21(25)24-12-4-5-13-24/h6-11,14,16,23H,4-5,12-13H2,1-3H3 |
| InChIKey | VRGXWKSPOVVNJP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |