C22H23F2N3O3S — CID 43020818
(E)-N-[1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enamide (PubChem CID 43020818) has the molecular formula C22H23F2N3O3S and a molecular weight of 447.51 g/mol. Its IUPAC name is (E)-N-[1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enamide.
| Compound Name | (E)-N-[1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 43020818 |
| Molecular Formula | C22H23F2N3O3S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | (E)-N-[1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enamide |
| SMILES | COc1cccc(/C=C/C(=O)NC(CCSC)c2nc3ccccc3[nH]2)c1OC(F)F |
| InChI | InChI=1S/C22H23F2N3O3S/c1-29-18-9-5-6-14(20(18)30-22(23)24)10-11-19(28)25-17(12-13-31-2)21-26-15-7-3-4-8-16(15)27-21/h3-11,17,22H,12-13H2,1-2H3,(H,25,28)(H,26,27)/b11-10+ |
| InChIKey | ULYUIKIUFUNWOP-ZHACJKMWSA-N |
| XLogP | 4.80 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|