C31H28N2O4 — CID 43024797
2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-phenyl-N-[(4-phenylmethoxyphenyl)methyl]acetamide (PubChem CID 43024797) has the molecular formula C31H28N2O4 and a molecular weight of 492.58 g/mol. Its IUPAC name is 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-phenyl-N-[(4-phenylmethoxyphenyl)methyl]acetamide.
| Compound Name | 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-phenyl-N-[(4-phenylmethoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 43024797 |
| Molecular Formula | C31H28N2O4 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-phenyl-N-[(4-phenylmethoxyphenyl)methyl]acetamide |
| SMILES | O=C1C2C3C=CC(C3)C2C(=O)N1CC(=O)N(Cc1ccc(OCc2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C31H28N2O4/c34-27(19-33-30(35)28-23-13-14-24(17-23)29(28)31(33)36)32(25-9-5-2-6-10-25)18-21-11-15-26(16-12-21)37-20-22-7-3-1-4-8-22/h1-16,23-24,28-29H,17-20H2 |
| InChIKey | VSWKHDNOKZUKKV-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|