C19H17N3O6S — CID 43029355
[2-(4-methyl-3-sulfamoylanilino)-2-oxoethyl] (E)-3-(1,3-benzoxazol-2-yl)prop-2-enoate (PubChem CID 43029355) has the molecular formula C19H17N3O6S and a molecular weight of 415.43 g/mol. Its IUPAC name is [2-(4-methyl-3-sulfamoylanilino)-2-oxoethyl] (E)-3-(1,3-benzoxazol-2-yl)prop-2-enoate.
| Compound Name | [2-(4-methyl-3-sulfamoylanilino)-2-oxoethyl] (E)-3-(1,3-benzoxazol-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 43029355 |
| Molecular Formula | C19H17N3O6S |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | [2-(4-methyl-3-sulfamoylanilino)-2-oxoethyl] (E)-3-(1,3-benzoxazol-2-yl)prop-2-enoate |
| SMILES | Cc1ccc(NC(=O)COC(=O)/C=C/c2nc3ccccc3o2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C19H17N3O6S/c1-12-6-7-13(10-16(12)29(20,25)26)21-17(23)11-27-19(24)9-8-18-22-14-4-2-3-5-15(14)28-18/h2-10H,11H2,1H3,(H,21,23)(H2,20,25,26)/b9-8+ |
| InChIKey | LGQLWDWTQAYCGX-CMDGGOBGSA-N |
| XLogP | 1.98 |
| TPSA | 141.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|