C21H31N3O4 — CID 43031509
2-(4-hexyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-[2-(3-methylphenoxy)ethyl]acetamide (PubChem CID 43031509) has the molecular formula C21H31N3O4 and a molecular weight of 389.50 g/mol. Its IUPAC name is 2-(4-hexyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-[2-(3-methylphenoxy)ethyl]acetamide.
| Compound Name | 2-(4-hexyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-[2-(3-methylphenoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 43031509 |
| Molecular Formula | C21H31N3O4 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | 2-(4-hexyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-[2-(3-methylphenoxy)ethyl]acetamide |
| SMILES | CCCCCCC1(C)NC(=O)N(CC(=O)NCCOc2cccc(C)c2)C1=O |
| InChI | InChI=1S/C21H31N3O4/c1-4-5-6-7-11-21(3)19(26)24(20(27)23-21)15-18(25)22-12-13-28-17-10-8-9-16(2)14-17/h8-10,14H,4-7,11-13,15H2,1-3H3,(H,22,25)(H,23,27) |
| InChIKey | JVZOXNZAEDLKKF-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|