C21H23N5O5 — CID 43046546
N'-[2-(2,3-dimethylphenoxy)propanoyl]-1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carbohydrazide (PubChem CID 43046546) has the molecular formula C21H23N5O5 and a molecular weight of 425.45 g/mol. Its IUPAC name is N'-[2-(2,3-dimethylphenoxy)propanoyl]-1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carbohydrazide.
| Compound Name | N'-[2-(2,3-dimethylphenoxy)propanoyl]-1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carbohydrazide |
|---|---|
| PubChem CID | 43046546 |
| Molecular Formula | C21H23N5O5 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | N'-[2-(2,3-dimethylphenoxy)propanoyl]-1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carbohydrazide |
| SMILES | Cc1cccc(OC(C)C(=O)NNC(=O)c2cnc3c(c2)c(=O)n(C)c(=O)n3C)c1C |
| InChI | InChI=1S/C21H23N5O5/c1-11-7-6-8-16(12(11)2)31-13(3)18(27)23-24-19(28)14-9-15-17(22-10-14)25(4)21(30)26(5)20(15)29/h6-10,13H,1-5H3,(H,23,27)(H,24,28) |
| InChIKey | ZFAUIEHTFNUWSW-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 124.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|