C20H23N5O3 — CID 51155324
N'-[2-(2,3-dimethylphenoxy)propanoyl]-1-ethylbenzotriazole-5-carbohydrazide (PubChem CID 51155324) has the molecular formula C20H23N5O3 and a molecular weight of 381.44 g/mol. Its IUPAC name is N'-[2-(2,3-dimethylphenoxy)propanoyl]-1-ethylbenzotriazole-5-carbohydrazide.
| Compound Name | N'-[2-(2,3-dimethylphenoxy)propanoyl]-1-ethylbenzotriazole-5-carbohydrazide |
|---|---|
| PubChem CID | 51155324 |
| Molecular Formula | C20H23N5O3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | N'-[2-(2,3-dimethylphenoxy)propanoyl]-1-ethylbenzotriazole-5-carbohydrazide |
| SMILES | CCn1nnc2cc(C(=O)NNC(=O)C(C)Oc3cccc(C)c3C)ccc21 |
| InChI | InChI=1S/C20H23N5O3/c1-5-25-17-10-9-15(11-16(17)21-24-25)20(27)23-22-19(26)14(4)28-18-8-6-7-12(2)13(18)3/h6-11,14H,5H2,1-4H3,(H,22,26)(H,23,27) |
| InChIKey | PABNBHWCWLTVDU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|