C14H12Cl2N2OS — CID 43054352
N-[(2,4-dichlorophenyl)methyl]-N-methyl-2-sulfanylidene-1H-pyridine-3-carboxamide (PubChem CID 43054352) has the molecular formula C14H12Cl2N2OS and a molecular weight of 327.24 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]-N-methyl-2-sulfanylidene-1H-pyridine-3-carboxamide.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]-N-methyl-2-sulfanylidene-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 43054352 |
| Molecular Formula | C14H12Cl2N2OS |
| Molecular Weight | 327.24 g/mol |
| Exact Mass | 326.00 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]-N-methyl-2-sulfanylidene-1H-pyridine-3-carboxamide |
| SMILES | CN(Cc1ccc(Cl)cc1Cl)C(=O)c1ccc[nH]c1=S |
| InChI | InChI=1S/C14H12Cl2N2OS/c1-18(8-9-4-5-10(15)7-12(9)16)14(19)11-3-2-6-17-13(11)20/h2-7H,8H2,1H3,(H,17,20) |
| InChIKey | OOKVRBHMCSSVMW-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.24 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|