C22H22FN3O4S — CID 43066570
N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide (PubChem CID 43066570) has the molecular formula C22H22FN3O4S and a molecular weight of 443.50 g/mol. Its IUPAC name is N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 43066570 |
| Molecular Formula | C22H22FN3O4S |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide |
| SMILES | O=C(NCc1ccc(-c2ccc(F)cc2)o1)C1CCN(S(=O)(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C22H22FN3O4S/c23-18-5-3-16(4-6-18)21-8-7-19(30-21)14-25-22(27)17-9-12-26(13-10-17)31(28,29)20-2-1-11-24-15-20/h1-8,11,15,17H,9-10,12-14H2,(H,25,27) |
| InChIKey | SGNPWAXJVJTDSF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |