C24H29N3O2S — CID 43067592
N-[2-(diethylamino)-3-phenylpropyl]-3-(1,3-thiazol-4-ylmethoxy)benzamide (PubChem CID 43067592) has the molecular formula C24H29N3O2S and a molecular weight of 423.58 g/mol. Its IUPAC name is N-[2-(diethylamino)-3-phenylpropyl]-3-(1,3-thiazol-4-ylmethoxy)benzamide.
| Compound Name | N-[2-(diethylamino)-3-phenylpropyl]-3-(1,3-thiazol-4-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 43067592 |
| Molecular Formula | C24H29N3O2S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | N-[2-(diethylamino)-3-phenylpropyl]-3-(1,3-thiazol-4-ylmethoxy)benzamide |
| SMILES | CCN(CC)C(CNC(=O)c1cccc(OCc2cscn2)c1)Cc1ccccc1 |
| InChI | InChI=1S/C24H29N3O2S/c1-3-27(4-2)22(13-19-9-6-5-7-10-19)15-25-24(28)20-11-8-12-23(14-20)29-16-21-17-30-18-26-21/h5-12,14,17-18,22H,3-4,13,15-16H2,1-2H3,(H,25,28) |
| InChIKey | HIJJORADAAZIAE-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |