C22H26N6O4S — CID 43070412
N'-[2-(benzimidazol-1-yl)propanoyl]-4-(4-methylpiperazin-1-yl)sulfonylbenzohydrazide (PubChem CID 43070412) has the molecular formula C22H26N6O4S and a molecular weight of 470.56 g/mol. Its IUPAC name is N'-[2-(benzimidazol-1-yl)propanoyl]-4-(4-methylpiperazin-1-yl)sulfonylbenzohydrazide.
| Compound Name | N'-[2-(benzimidazol-1-yl)propanoyl]-4-(4-methylpiperazin-1-yl)sulfonylbenzohydrazide |
|---|---|
| PubChem CID | 43070412 |
| Molecular Formula | C22H26N6O4S |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | N'-[2-(benzimidazol-1-yl)propanoyl]-4-(4-methylpiperazin-1-yl)sulfonylbenzohydrazide |
| SMILES | CC(C(=O)NNC(=O)c1ccc(S(=O)(=O)N2CCN(C)CC2)cc1)n1cnc2ccccc21 |
| InChI | InChI=1S/C22H26N6O4S/c1-16(28-15-23-19-5-3-4-6-20(19)28)21(29)24-25-22(30)17-7-9-18(10-8-17)33(31,32)27-13-11-26(2)12-14-27/h3-10,15-16H,11-14H2,1-2H3,(H,24,29)(H,25,30) |
| InChIKey | XFUFXWZRLNGKNL-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 116.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|