C22H21F3N4O4S — CID 43074489
ethyl 1-[4-[4-(thiophene-3-carbonylamino)butanoylamino]phenyl]-5-(trifluoromethyl)pyrazole-4-carboxylate (PubChem CID 43074489) has the molecular formula C22H21F3N4O4S and a molecular weight of 494.50 g/mol. Its IUPAC name is ethyl 1-[4-[4-(thiophene-3-carbonylamino)butanoylamino]phenyl]-5-(trifluoromethyl)pyrazole-4-carboxylate.
| Compound Name | ethyl 1-[4-[4-(thiophene-3-carbonylamino)butanoylamino]phenyl]-5-(trifluoromethyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 43074489 |
| Molecular Formula | C22H21F3N4O4S |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | ethyl 1-[4-[4-(thiophene-3-carbonylamino)butanoylamino]phenyl]-5-(trifluoromethyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2ccc(NC(=O)CCCNC(=O)c3ccsc3)cc2)c1C(F)(F)F |
| InChI | InChI=1S/C22H21F3N4O4S/c1-2-33-21(32)17-12-27-29(19(17)22(23,24)25)16-7-5-15(6-8-16)28-18(30)4-3-10-26-20(31)14-9-11-34-13-14/h5-9,11-13H,2-4,10H2,1H3,(H,26,31)(H,28,30) |
| InChIKey | HQHVZRVUOPBDPA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|