C16H19BrN2S — CID 43100076
N-[(5-bromothiophen-2-yl)methyl]-3-(2,3-dihydroindol-1-yl)propan-1-amine (PubChem CID 43100076) has the molecular formula C16H19BrN2S and a molecular weight of 351.31 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-3-(2,3-dihydroindol-1-yl)propan-1-amine.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-3-(2,3-dihydroindol-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 43100076 |
| Molecular Formula | C16H19BrN2S |
| Molecular Weight | 351.31 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-3-(2,3-dihydroindol-1-yl)propan-1-amine |
| SMILES | Brc1ccc(CNCCCN2CCc3ccccc32)s1 |
| InChI | InChI=1S/C16H19BrN2S/c17-16-7-6-14(20-16)12-18-9-3-10-19-11-8-13-4-1-2-5-15(13)19/h1-2,4-7,18H,3,8-12H2 |
| InChIKey | VHMWXEWYPQGUSJ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.31 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|