C16H22N2 — CID 43108999
N-(2,6-dimethylcyclohexyl)-1H-indol-5-amine (PubChem CID 43108999) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is N-(2,6-dimethylcyclohexyl)-1H-indol-5-amine.
| Compound Name | N-(2,6-dimethylcyclohexyl)-1H-indol-5-amine |
|---|---|
| PubChem CID | 43108999 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | N-(2,6-dimethylcyclohexyl)-1H-indol-5-amine |
| SMILES | CC1CCCC(C)C1Nc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C16H22N2/c1-11-4-3-5-12(2)16(11)18-14-6-7-15-13(10-14)8-9-17-15/h6-12,16-18H,3-5H2,1-2H3 |
| InChIKey | JFZZKOWYKOIQOH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |