C18H24N2O — CID 75951124
4-(1H-indol-5-ylamino)-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-4a-ol (PubChem CID 75951124) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is 4-(1H-indol-5-ylamino)-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-4a-ol.
| Compound Name | 4-(1H-indol-5-ylamino)-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-4a-ol |
|---|---|
| PubChem CID | 75951124 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 4-(1H-indol-5-ylamino)-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-4a-ol |
| SMILES | OC12CCCCC1CCCC2Nc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C18H24N2O/c21-18-10-2-1-4-14(18)5-3-6-17(18)20-15-7-8-16-13(12-15)9-11-19-16/h7-9,11-12,14,17,19-21H,1-6,10H2 |
| InChIKey | NMTHLWOMLNWQDS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |