C16H24N2O2 — CID 43115457
6-N-(2,3-dimethylcyclohexyl)-2,3-dihydro-1,4-benzodioxine-6,7-diamine (PubChem CID 43115457) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 6-N-(2,3-dimethylcyclohexyl)-2,3-dihydro-1,4-benzodioxine-6,7-diamine.
| Compound Name | 6-N-(2,3-dimethylcyclohexyl)-2,3-dihydro-1,4-benzodioxine-6,7-diamine |
|---|---|
| PubChem CID | 43115457 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 6-N-(2,3-dimethylcyclohexyl)-2,3-dihydro-1,4-benzodioxine-6,7-diamine |
| SMILES | CC1CCCC(Nc2cc3c(cc2N)OCCO3)C1C |
| InChI | InChI=1S/C16H24N2O2/c1-10-4-3-5-13(11(10)2)18-14-9-16-15(8-12(14)17)19-6-7-20-16/h8-11,13,18H,3-7,17H2,1-2H3 |
| InChIKey | GMYLLVFGUVZAPD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|