C15H14BrClFNO2 — CID 43118226
(2-bromo-4,5-dimethoxyphenyl)-(2-chloro-4-fluorophenyl)methanamine (PubChem CID 43118226) has the molecular formula C15H14BrClFNO2 and a molecular weight of 374.64 g/mol. Its IUPAC name is (2-bromo-4,5-dimethoxyphenyl)-(2-chloro-4-fluorophenyl)methanamine.
| Compound Name | (2-bromo-4,5-dimethoxyphenyl)-(2-chloro-4-fluorophenyl)methanamine |
|---|---|
| PubChem CID | 43118226 |
| Molecular Formula | C15H14BrClFNO2 |
| Molecular Weight | 374.64 g/mol |
| Exact Mass | 372.99 |
| IUPAC Name | (2-bromo-4,5-dimethoxyphenyl)-(2-chloro-4-fluorophenyl)methanamine |
| SMILES | COc1cc(Br)c(C(N)c2ccc(F)cc2Cl)cc1OC |
| InChI | InChI=1S/C15H14BrClFNO2/c1-20-13-6-10(11(16)7-14(13)21-2)15(19)9-4-3-8(18)5-12(9)17/h3-7,15H,19H2,1-2H3 |
| InChIKey | QIFLUTRVHIYGSX-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.64 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |