C13H8BrNO2S — CID 43118444
2-(1,3-benzothiazol-2-yl)-1-(5-bromofuran-2-yl)ethanone (PubChem CID 43118444) has the molecular formula C13H8BrNO2S and a molecular weight of 322.18 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-1-(5-bromofuran-2-yl)ethanone.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-1-(5-bromofuran-2-yl)ethanone |
|---|---|
| PubChem CID | 43118444 |
| Molecular Formula | C13H8BrNO2S |
| Molecular Weight | 322.18 g/mol |
| Exact Mass | 320.95 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-1-(5-bromofuran-2-yl)ethanone |
| SMILES | O=C(Cc1nc2ccccc2s1)c1ccc(Br)o1 |
| InChI | InChI=1S/C13H8BrNO2S/c14-12-6-5-10(17-12)9(16)7-13-15-8-3-1-2-4-11(8)18-13/h1-6H,7H2 |
| InChIKey | QOVMNIDKWZCWAM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.18 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |