C28H28Cl2N4O2S — CID 4312173
N-[1-[5-benzylsulfanyl-4-(2,5-dichlorophenyl)-1,2,4-triazol-3-yl]ethyl]-4-butoxybenzamide (PubChem CID 4312173) has the molecular formula C28H28Cl2N4O2S and a molecular weight of 555.53 g/mol. Its IUPAC name is N-[1-[5-benzylsulfanyl-4-(2,5-dichlorophenyl)-1,2,4-triazol-3-yl]ethyl]-4-butoxybenzamide.
| Compound Name | N-[1-[5-benzylsulfanyl-4-(2,5-dichlorophenyl)-1,2,4-triazol-3-yl]ethyl]-4-butoxybenzamide |
|---|---|
| PubChem CID | 4312173 |
| Molecular Formula | C28H28Cl2N4O2S |
| Molecular Weight | 555.53 g/mol |
| Exact Mass | 554.13 |
| IUPAC Name | N-[1-[5-benzylsulfanyl-4-(2,5-dichlorophenyl)-1,2,4-triazol-3-yl]ethyl]-4-butoxybenzamide |
| SMILES | CCCCOc1ccc(C(=O)NC(C)c2nnc(SCc3ccccc3)n2-c2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C28H28Cl2N4O2S/c1-3-4-16-36-23-13-10-21(11-14-23)27(35)31-19(2)26-32-33-28(37-18-20-8-6-5-7-9-20)34(26)25-17-22(29)12-15-24(25)30/h5-15,17,19H,3-4,16,18H2,1-2H3,(H,31,35) |
| InChIKey | NTTGLECCKTYFSA-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.53 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|