2-(2,3-dihydroindole-1-carbonyl)-6-nitrobenzoic acid

C16H12N2O5 — CID 4313762

IUPAC2-(2,3-dihydroindole-1-carbonyl)-6-nitrobenzoic acid
SMILESO=C(O)c1c(C(=O)N2CCc3ccccc32)cccc1[N+](=O)[O-]
InChIInChI=1S/C16H12N2O5/c19-15(17-9-8-10-4-1-2-6-12(10)17)11-5-3-7-13(18(22)23)14(11)16(20)21/h1-7H,8-9H2,(H,20,21)
InChIKeyHENQTGFJMJKQLK-UHFFFAOYSA-N
MW312.28 g/mol
LogP2.50
Rot. Bonds3

About 2-(2,3-dihydroindole-1-carbonyl)-6-nitrobenzoic acid

2-(2,3-dihydroindole-1-carbonyl)-6-nitrobenzoic acid (PubChem CID 4313762) has the molecular formula C16H12N2O5 and a molecular weight of 312.28 g/mol. Its IUPAC name is 2-(2,3-dihydroindole-1-carbonyl)-6-nitrobenzoic acid.

Molecular Properties

Compound Name2-(2,3-dihydroindole-1-carbonyl)-6-nitrobenzoic acid
PubChem CID4313762
Molecular FormulaC16H12N2O5
Molecular Weight312.28 g/mol
Exact Mass312.07
IUPAC Name2-(2,3-dihydroindole-1-carbonyl)-6-nitrobenzoic acid
SMILESO=C(O)c1c(C(=O)N2CCc3ccccc32)cccc1[N+](=O)[O-]
InChIInChI=1S/C16H12N2O5/c19-15(17-9-8-10-4-1-2-6-12(10)17)11-5-3-7-13(18(22)23)14(11)16(20)21/h1-7H,8-9H2,(H,20,21)
InChIKeyHENQTGFJMJKQLK-UHFFFAOYSA-N
XLogP2.50
TPSA100.75 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500312.28
LogP ≤ 52.50
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-(2,3-dihydroindole-1-carbonyl)-6-nitrobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,3-dihydroindole-1-carbonyl)-6-nitrobenzoic acid?
The IUPAC name of 2-(2,3-dihydroindole-1-carbonyl)-6-nitrobenzoic acid (CID 4313762) is 2-(2,3-dihydroindole-1-carbonyl)-6-nitrobenzoic acid.
What is the SMILES notation for 2-(2,3-dihydroindole-1-carbonyl)-6-nitrobenzoic acid?
The canonical SMILES for 2-(2,3-dihydroindole-1-carbonyl)-6-nitrobenzoic acid is O=C(O)c1c(C(=O)N2CCc3ccccc32)cccc1[N+](=O)[O-].
What is the InChIKey of 2-(2,3-dihydroindole-1-carbonyl)-6-nitrobenzoic acid?
The InChIKey is HENQTGFJMJKQLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2O5/c19-15(17-9-8-10-4-1-2-6-12(10)17)11-5-3-7-13(18(22)23)14(11)16(20)21/h1-7H,8-9H2,(H,20,21).
What are the key properties of 2-(2,3-dihydroindole-1-carbonyl)-6-nitrobenzoic acid?
2-(2,3-dihydroindole-1-carbonyl)-6-nitrobenzoic acid has a molecular weight of 312.28 g/mol, XLogP of 2.50, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dihydroindole-1-carbonyl)-6-nitrobenzoic acid is sourced from PubChem (CID 4313762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).