C9H20N2O3 — CID 43175231
N'-hydroxy-2-methyl-3-(2-propan-2-yloxyethoxy)propanimidamide (PubChem CID 43175231) has the molecular formula C9H20N2O3 and a molecular weight of 204.27 g/mol. Its IUPAC name is N'-hydroxy-2-methyl-3-(2-propan-2-yloxyethoxy)propanimidamide.
| Compound Name | N'-hydroxy-2-methyl-3-(2-propan-2-yloxyethoxy)propanimidamide |
|---|---|
| PubChem CID | 43175231 |
| Molecular Formula | C9H20N2O3 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | N'-hydroxy-2-methyl-3-(2-propan-2-yloxyethoxy)propanimidamide |
| SMILES | CC(C)OCCOCC(C)/C(N)=N/O |
| InChI | InChI=1S/C9H20N2O3/c1-7(2)14-5-4-13-6-8(3)9(10)11-12/h7-8,12H,4-6H2,1-3H3,(H2,10,11) |
| InChIKey | AXZYPFZMZHBNDV-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|