C13H20N2S — CID 43175421
3-(2,5-dimethylphenyl)sulfanylpentanimidamide (PubChem CID 43175421) has the molecular formula C13H20N2S and a molecular weight of 236.38 g/mol. Its IUPAC name is 3-(2,5-dimethylphenyl)sulfanylpentanimidamide.
| Compound Name | 3-(2,5-dimethylphenyl)sulfanylpentanimidamide |
|---|---|
| PubChem CID | 43175421 |
| Molecular Formula | C13H20N2S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 3-(2,5-dimethylphenyl)sulfanylpentanimidamide |
| SMILES | [H]/N=C(\N)CC(CC)Sc1cc(C)ccc1C |
| InChI | InChI=1S/C13H20N2S/c1-4-11(8-13(14)15)16-12-7-9(2)5-6-10(12)3/h5-7,11H,4,8H2,1-3H3,(H3,14,15) |
| InChIKey | URJUGLLLXDUKCJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|