C16H19NOS — CID 43182769
N-[(4-prop-2-enoxyphenyl)methyl]-1-thiophen-2-ylethanamine (PubChem CID 43182769) has the molecular formula C16H19NOS and a molecular weight of 273.40 g/mol. Its IUPAC name is N-[(4-prop-2-enoxyphenyl)methyl]-1-thiophen-2-ylethanamine.
| Compound Name | N-[(4-prop-2-enoxyphenyl)methyl]-1-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 43182769 |
| Molecular Formula | C16H19NOS |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | N-[(4-prop-2-enoxyphenyl)methyl]-1-thiophen-2-ylethanamine |
| SMILES | C=CCOc1ccc(CNC(C)c2cccs2)cc1 |
| InChI | InChI=1S/C16H19NOS/c1-3-10-18-15-8-6-14(7-9-15)12-17-13(2)16-5-4-11-19-16/h3-9,11,13,17H,1,10,12H2,2H3 |
| InChIKey | WNBKLGQALVQGOT-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|