C12H16BrFN2 — CID 43187006
[1-[(5-bromo-2-fluorophenyl)methyl]pyrrolidin-2-yl]methanamine (PubChem CID 43187006) has the molecular formula C12H16BrFN2 and a molecular weight of 287.18 g/mol. Its IUPAC name is [1-[(5-bromo-2-fluorophenyl)methyl]pyrrolidin-2-yl]methanamine.
| Compound Name | [1-[(5-bromo-2-fluorophenyl)methyl]pyrrolidin-2-yl]methanamine |
|---|---|
| PubChem CID | 43187006 |
| Molecular Formula | C12H16BrFN2 |
| Molecular Weight | 287.18 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | [1-[(5-bromo-2-fluorophenyl)methyl]pyrrolidin-2-yl]methanamine |
| SMILES | NCC1CCCN1Cc1cc(Br)ccc1F |
| InChI | InChI=1S/C12H16BrFN2/c13-10-3-4-12(14)9(6-10)8-16-5-1-2-11(16)7-15/h3-4,6,11H,1-2,5,7-8,15H2 |
| InChIKey | KZYIQXFYBVOQFD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.18 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |