C15H22BrFN2 — CID 62580390
N-[[1-[(5-bromo-2-fluorophenyl)methyl]piperidin-2-yl]methyl]ethanamine (PubChem CID 62580390) has the molecular formula C15H22BrFN2 and a molecular weight of 329.26 g/mol. Its IUPAC name is N-[[1-[(5-bromo-2-fluorophenyl)methyl]piperidin-2-yl]methyl]ethanamine.
| Compound Name | N-[[1-[(5-bromo-2-fluorophenyl)methyl]piperidin-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 62580390 |
| Molecular Formula | C15H22BrFN2 |
| Molecular Weight | 329.26 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | N-[[1-[(5-bromo-2-fluorophenyl)methyl]piperidin-2-yl]methyl]ethanamine |
| SMILES | CCNCC1CCCCN1Cc1cc(Br)ccc1F |
| InChI | InChI=1S/C15H22BrFN2/c1-2-18-10-14-5-3-4-8-19(14)11-12-9-13(16)6-7-15(12)17/h6-7,9,14,18H,2-5,8,10-11H2,1H3 |
| InChIKey | UXCUOEQVGGEWDD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.26 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |