C15H20BrFN2 — CID 62581260
N-[[1-[(5-bromo-2-fluorophenyl)methyl]pyrrolidin-2-yl]methyl]cyclopropanamine (PubChem CID 62581260) has the molecular formula C15H20BrFN2 and a molecular weight of 327.24 g/mol. Its IUPAC name is N-[[1-[(5-bromo-2-fluorophenyl)methyl]pyrrolidin-2-yl]methyl]cyclopropanamine.
| Compound Name | N-[[1-[(5-bromo-2-fluorophenyl)methyl]pyrrolidin-2-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 62581260 |
| Molecular Formula | C15H20BrFN2 |
| Molecular Weight | 327.24 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | N-[[1-[(5-bromo-2-fluorophenyl)methyl]pyrrolidin-2-yl]methyl]cyclopropanamine |
| SMILES | Fc1ccc(Br)cc1CN1CCCC1CNC1CC1 |
| InChI | InChI=1S/C15H20BrFN2/c16-12-3-6-15(17)11(8-12)10-19-7-1-2-14(19)9-18-13-4-5-13/h3,6,8,13-14,18H,1-2,4-5,7,9-10H2 |
| InChIKey | WZMOUPIWXWTWCE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.24 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |