C16H24BrFN2 — CID 62581106
N-[[1-[(5-bromo-2-fluorophenyl)methyl]pyrrolidin-2-yl]methyl]-2-methylpropan-1-amine (PubChem CID 62581106) has the molecular formula C16H24BrFN2 and a molecular weight of 343.28 g/mol. Its IUPAC name is N-[[1-[(5-bromo-2-fluorophenyl)methyl]pyrrolidin-2-yl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[1-[(5-bromo-2-fluorophenyl)methyl]pyrrolidin-2-yl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 62581106 |
| Molecular Formula | C16H24BrFN2 |
| Molecular Weight | 343.28 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | N-[[1-[(5-bromo-2-fluorophenyl)methyl]pyrrolidin-2-yl]methyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCC1CCCN1Cc1cc(Br)ccc1F |
| InChI | InChI=1S/C16H24BrFN2/c1-12(2)9-19-10-15-4-3-7-20(15)11-13-8-14(17)5-6-16(13)18/h5-6,8,12,15,19H,3-4,7,9-11H2,1-2H3 |
| InChIKey | RQZJZZGORRVHSG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.28 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |