C25H23BrN2O2S — CID 4319389
5-[[4-[(4-bromophenyl)methoxy]phenyl]methylidene]-2-(4-ethylanilino)-1,3-thiazolidin-4-one (PubChem CID 4319389) has the molecular formula C25H23BrN2O2S and a molecular weight of 495.44 g/mol. Its IUPAC name is 5-[[4-[(4-bromophenyl)methoxy]phenyl]methylidene]-2-(4-ethylanilino)-1,3-thiazolidin-4-one.
| Compound Name | 5-[[4-[(4-bromophenyl)methoxy]phenyl]methylidene]-2-(4-ethylanilino)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4319389 |
| Molecular Formula | C25H23BrN2O2S |
| Molecular Weight | 495.44 g/mol |
| Exact Mass | 494.07 |
| IUPAC Name | 5-[[4-[(4-bromophenyl)methoxy]phenyl]methylidene]-2-(4-ethylanilino)-1,3-thiazolidin-4-one |
| SMILES | CCc1ccc(NC2NC(=O)C(=Cc3ccc(OCc4ccc(Br)cc4)cc3)S2)cc1 |
| InChI | InChI=1S/C25H23BrN2O2S/c1-2-17-5-11-21(12-6-17)27-25-28-24(29)23(31-25)15-18-7-13-22(14-8-18)30-16-19-3-9-20(26)10-4-19/h3-15,25,27H,2,16H2,1H3,(H,28,29) |
| InChIKey | HPBVBJNAUDTMJC-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.44 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|