C20H21BrN2O3S — CID 26987444
(2S,5E)-5-[(3-bromo-4,5-dimethoxyphenyl)methylidene]-2-(4-ethylanilino)-1,3-thiazolidin-4-one (PubChem CID 26987444) has the molecular formula C20H21BrN2O3S and a molecular weight of 449.37 g/mol. Its IUPAC name is (2S,5E)-5-[(3-bromo-4,5-dimethoxyphenyl)methylidene]-2-(4-ethylanilino)-1,3-thiazolidin-4-one.
| Compound Name | (2S,5E)-5-[(3-bromo-4,5-dimethoxyphenyl)methylidene]-2-(4-ethylanilino)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 26987444 |
| Molecular Formula | C20H21BrN2O3S |
| Molecular Weight | 449.37 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | (2S,5E)-5-[(3-bromo-4,5-dimethoxyphenyl)methylidene]-2-(4-ethylanilino)-1,3-thiazolidin-4-one |
| SMILES | CCc1ccc(N[C@H]2NC(=O)/C(=C\c3cc(Br)c(OC)c(OC)c3)S2)cc1 |
| InChI | InChI=1S/C20H21BrN2O3S/c1-4-12-5-7-14(8-6-12)22-20-23-19(24)17(27-20)11-13-9-15(21)18(26-3)16(10-13)25-2/h5-11,20,22H,4H2,1-3H3,(H,23,24)/b17-11+/t20-/m0/s1 |
| InChIKey | GTECYUQFKUZYNQ-KDMTZKAISA-N |
| XLogP | 4.63 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.37 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|