C22H19BrN2O2S — CID 6115654
(5E)-5-[[5-(4-bromophenyl)furan-2-yl]methylidene]-2-(4-ethylanilino)-1,3-thiazolidin-4-one (PubChem CID 6115654) has the molecular formula C22H19BrN2O2S and a molecular weight of 455.38 g/mol. Its IUPAC name is (5E)-5-[[5-(4-bromophenyl)furan-2-yl]methylidene]-2-(4-ethylanilino)-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[5-(4-bromophenyl)furan-2-yl]methylidene]-2-(4-ethylanilino)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6115654 |
| Molecular Formula | C22H19BrN2O2S |
| Molecular Weight | 455.38 g/mol |
| Exact Mass | 454.04 |
| IUPAC Name | (5E)-5-[[5-(4-bromophenyl)furan-2-yl]methylidene]-2-(4-ethylanilino)-1,3-thiazolidin-4-one |
| SMILES | CCc1ccc(NC2NC(=O)/C(=C\c3ccc(-c4ccc(Br)cc4)o3)S2)cc1 |
| InChI | InChI=1S/C22H19BrN2O2S/c1-2-14-3-9-17(10-4-14)24-22-25-21(26)20(28-22)13-18-11-12-19(27-18)15-5-7-16(23)8-6-15/h3-13,22,24H,2H2,1H3,(H,25,26)/b20-13+ |
| InChIKey | GCAXAOKVTQVTJZ-DEDYPNTBSA-N |
| XLogP | 5.87 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.38 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|