About 2-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]propanoic acid
2-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]propanoic acid (PubChem CID 43211074) has the molecular formula C7H9N3O4
and a molecular weight of 199.17 g/mol. Its IUPAC name is 2-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]propanoic acid.
Analyze 2-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]propanoic acid?
The IUPAC name of 2-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]propanoic acid (CID 43211074) is 2-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]propanoic acid.
What is the SMILES notation for 2-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]propanoic acid?
The canonical SMILES for 2-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]propanoic acid is CC(NC(=O)c1c[nH]c(=O)[nH]1)C(=O)O.
What is the InChIKey of 2-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]propanoic acid?
The InChIKey is YKTMGZYBAVYSNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O4/c1-3(6(12)13)9-5(11)4-2-8-7(14)10-4/h2-3H,1H3,(H,9,11)(H,12,13)(H2,8,10,14).
What are the key properties of 2-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]propanoic acid?
2-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]propanoic acid has a molecular weight of 199.17 g/mol, XLogP of -1.09, 3 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]propanoic acid is sourced from PubChem (CID 43211074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).