C13H21ClN2S — CID 43266689
4-(chloromethyl)-2-[2-(2-ethylpiperidin-1-yl)ethyl]-1,3-thiazole (PubChem CID 43266689) has the molecular formula C13H21ClN2S and a molecular weight of 272.84 g/mol. Its IUPAC name is 4-(chloromethyl)-2-[2-(2-ethylpiperidin-1-yl)ethyl]-1,3-thiazole.
| Compound Name | 4-(chloromethyl)-2-[2-(2-ethylpiperidin-1-yl)ethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 43266689 |
| Molecular Formula | C13H21ClN2S |
| Molecular Weight | 272.84 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 4-(chloromethyl)-2-[2-(2-ethylpiperidin-1-yl)ethyl]-1,3-thiazole |
| SMILES | CCC1CCCCN1CCc1nc(CCl)cs1 |
| InChI | InChI=1S/C13H21ClN2S/c1-2-12-5-3-4-7-16(12)8-6-13-15-11(9-14)10-17-13/h10,12H,2-9H2,1H3 |
| InChIKey | WJCLSHVNNNYOLN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.84 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|