C13H12ClNO5 — CID 43330640
5-(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)-5-oxopentanoic acid (PubChem CID 43330640) has the molecular formula C13H12ClNO5 and a molecular weight of 297.69 g/mol. Its IUPAC name is 5-(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)-5-oxopentanoic acid.
| Compound Name | 5-(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 43330640 |
| Molecular Formula | C13H12ClNO5 |
| Molecular Weight | 297.69 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 5-(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)-5-oxopentanoic acid |
| SMILES | O=C(O)CCCC(=O)c1cc2c(cc1Cl)NC(=O)CO2 |
| InChI | InChI=1S/C13H12ClNO5/c14-8-5-9-11(20-6-12(17)15-9)4-7(8)10(16)2-1-3-13(18)19/h4-5H,1-3,6H2,(H,15,17)(H,18,19) |
| InChIKey | ZEZRZFBUUNRCSY-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.69 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |