C9H9ClN2O2 — CID 82508575
7-(aminomethyl)-6-chloro-4H-1,4-benzoxazin-3-one (PubChem CID 82508575) has the molecular formula C9H9ClN2O2 and a molecular weight of 212.64 g/mol. Its IUPAC name is 7-(aminomethyl)-6-chloro-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-(aminomethyl)-6-chloro-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82508575 |
| Molecular Formula | C9H9ClN2O2 |
| Molecular Weight | 212.64 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 7-(aminomethyl)-6-chloro-4H-1,4-benzoxazin-3-one |
| SMILES | NCc1cc2c(cc1Cl)NC(=O)CO2 |
| InChI | InChI=1S/C9H9ClN2O2/c10-6-2-7-8(1-5(6)3-11)14-4-9(13)12-7/h1-2H,3-4,11H2,(H,12,13) |
| InChIKey | GDCVPWPMSHREIJ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.64 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |