C8H5ClNNaO4S — CID 114287132
sodium 6-chloro-3-oxo-4H-1,4-benzoxazine-7-sulfinate (PubChem CID 114287132) has the molecular formula C8H5ClNNaO4S and a molecular weight of 269.64 g/mol. Its IUPAC name is sodium 6-chloro-3-oxo-4H-1,4-benzoxazine-7-sulfinate.
| Compound Name | sodium 6-chloro-3-oxo-4H-1,4-benzoxazine-7-sulfinate |
|---|---|
| PubChem CID | 114287132 |
| Molecular Formula | C8H5ClNNaO4S |
| Molecular Weight | 269.64 g/mol |
| Exact Mass | 268.95 |
| IUPAC Name | sodium 6-chloro-3-oxo-4H-1,4-benzoxazine-7-sulfinate |
| SMILES | O=C1COc2cc(S(=O)[O-])c(Cl)cc2N1.[Na+] |
| InChI | InChI=1S/C8H6ClNO4S.Na/c9-4-1-5-6(2-7(4)15(12)13)14-3-8(11)10-5;/h1-2H,3H2,(H,10,11)(H,12,13);/q;+1/p-1 |
| InChIKey | BEMVOGUGTALWNV-UHFFFAOYSA-M |
| XLogP | -2.09 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.64 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|