C12H11BrClNO3 — CID 63386294
7-(2-bromobutanoyl)-6-chloro-4H-1,4-benzoxazin-3-one (PubChem CID 63386294) has the molecular formula C12H11BrClNO3 and a molecular weight of 332.58 g/mol. Its IUPAC name is 7-(2-bromobutanoyl)-6-chloro-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-(2-bromobutanoyl)-6-chloro-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 63386294 |
| Molecular Formula | C12H11BrClNO3 |
| Molecular Weight | 332.58 g/mol |
| Exact Mass | 330.96 |
| IUPAC Name | 7-(2-bromobutanoyl)-6-chloro-4H-1,4-benzoxazin-3-one |
| SMILES | CCC(Br)C(=O)c1cc2c(cc1Cl)NC(=O)CO2 |
| InChI | InChI=1S/C12H11BrClNO3/c1-2-7(13)12(17)6-3-10-9(4-8(6)14)15-11(16)5-18-10/h3-4,7H,2,5H2,1H3,(H,15,16) |
| InChIKey | XJYKHGFGXIKKMJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.58 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|