C11H15N3O5 — CID 43355097
4-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]butanoic acid (PubChem CID 43355097) has the molecular formula C11H15N3O5 and a molecular weight of 269.26 g/mol. Its IUPAC name is 4-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]butanoic acid.
| Compound Name | 4-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 43355097 |
| Molecular Formula | C11H15N3O5 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 4-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]butanoic acid |
| SMILES | Cn1c(=O)ccn(CC(=O)NCCCC(=O)O)c1=O |
| InChI | InChI=1S/C11H15N3O5/c1-13-9(16)4-6-14(11(13)19)7-8(15)12-5-2-3-10(17)18/h4,6H,2-3,5,7H2,1H3,(H,12,15)(H,17,18) |
| InChIKey | BGQXXVJELZUJPA-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 110.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|