C15H12F2N2S — CID 43385114
N-(2,4-difluorophenyl)-5-phenyl-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 43385114) has the molecular formula C15H12F2N2S and a molecular weight of 290.34 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-5-phenyl-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | N-(2,4-difluorophenyl)-5-phenyl-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 43385114 |
| Molecular Formula | C15H12F2N2S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | N-(2,4-difluorophenyl)-5-phenyl-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | Fc1ccc(NC2=NCC(c3ccccc3)S2)c(F)c1 |
| InChI | InChI=1S/C15H12F2N2S/c16-11-6-7-13(12(17)8-11)19-15-18-9-14(20-15)10-4-2-1-3-5-10/h1-8,14H,9H2,(H,18,19) |
| InChIKey | PNTRSRUACGBZOL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |