C11H12F2N2 — CID 79508328
N-(2,4-difluorophenyl)-2,3,4,5-tetrahydropyridin-6-amine (PubChem CID 79508328) has the molecular formula C11H12F2N2 and a molecular weight of 210.23 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2,3,4,5-tetrahydropyridin-6-amine.
| Compound Name | N-(2,4-difluorophenyl)-2,3,4,5-tetrahydropyridin-6-amine |
|---|---|
| PubChem CID | 79508328 |
| Molecular Formula | C11H12F2N2 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | N-(2,4-difluorophenyl)-2,3,4,5-tetrahydropyridin-6-amine |
| SMILES | Fc1ccc(NC2=NCCCC2)c(F)c1 |
| InChI | InChI=1S/C11H12F2N2/c12-8-4-5-10(9(13)7-8)15-11-3-1-2-6-14-11/h4-5,7H,1-3,6H2,(H,14,15) |
| InChIKey | AVJSRIUARJJSPL-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |