C8H16N2O3S — CID 43417552
3-(2-amino-2-oxoethyl)sulfanyl-N-(3-hydroxypropyl)propanamide (PubChem CID 43417552) has the molecular formula C8H16N2O3S and a molecular weight of 220.29 g/mol. Its IUPAC name is 3-(2-amino-2-oxoethyl)sulfanyl-N-(3-hydroxypropyl)propanamide.
| Compound Name | 3-(2-amino-2-oxoethyl)sulfanyl-N-(3-hydroxypropyl)propanamide |
|---|---|
| PubChem CID | 43417552 |
| Molecular Formula | C8H16N2O3S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 3-(2-amino-2-oxoethyl)sulfanyl-N-(3-hydroxypropyl)propanamide |
| SMILES | NC(=O)CSCCC(=O)NCCCO |
| InChI | InChI=1S/C8H16N2O3S/c9-7(12)6-14-5-2-8(13)10-3-1-4-11/h11H,1-6H2,(H2,9,12)(H,10,13) |
| InChIKey | REARRNBWTCYXGR-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|