C11H15NO2S — CID 43417774
(E)-N-(3-hydroxypropyl)-3-(3-methylthiophen-2-yl)prop-2-enamide (PubChem CID 43417774) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is (E)-N-(3-hydroxypropyl)-3-(3-methylthiophen-2-yl)prop-2-enamide.
| Compound Name | (E)-N-(3-hydroxypropyl)-3-(3-methylthiophen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 43417774 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | (E)-N-(3-hydroxypropyl)-3-(3-methylthiophen-2-yl)prop-2-enamide |
| SMILES | Cc1ccsc1/C=C/C(=O)NCCCO |
| InChI | InChI=1S/C11H15NO2S/c1-9-5-8-15-10(9)3-4-11(14)12-6-2-7-13/h3-5,8,13H,2,6-7H2,1H3,(H,12,14)/b4-3+ |
| InChIKey | SQZMIFCBMMVFNW-ONEGZZNKSA-N |
| XLogP | 1.57 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|