C12H16N2O5 — CID 43424660
2-[[2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)acetyl]amino]acetic acid (PubChem CID 43424660) has the molecular formula C12H16N2O5 and a molecular weight of 268.27 g/mol. Its IUPAC name is 2-[[2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)acetyl]amino]acetic acid.
| Compound Name | 2-[[2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 43424660 |
| Molecular Formula | C12H16N2O5 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 2-[[2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)acetyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)CN1C(=O)CC2(CCCC2)C1=O |
| InChI | InChI=1S/C12H16N2O5/c15-8(13-6-10(17)18)7-14-9(16)5-12(11(14)19)3-1-2-4-12/h1-7H2,(H,13,15)(H,17,18) |
| InChIKey | PRYWAWKBSHOKSL-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|