About 5-(2-methylmorpholin-4-yl)-1,3-benzothiazol-4-amine
5-(2-methylmorpholin-4-yl)-1,3-benzothiazol-4-amine (PubChem CID 43451171) has the molecular formula C12H15N3OS
and a molecular weight of 249.34 g/mol. Its IUPAC name is 5-(2-methylmorpholin-4-yl)-1,3-benzothiazol-4-amine.
Molecular Properties
| Compound Name | 5-(2-methylmorpholin-4-yl)-1,3-benzothiazol-4-amine |
| PubChem CID | 43451171 |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 5-(2-methylmorpholin-4-yl)-1,3-benzothiazol-4-amine |
| SMILES | CC1CN(c2ccc3scnc3c2N)CCO1 |
| InChI | InChI=1S/C12H15N3OS/c1-8-6-15(4-5-16-8)9-2-3-10-12(11(9)13)14-7-17-10/h2-3,7-8H,4-6,13H2,1H3 |
| InChIKey | HAHBMEXDNLMLLO-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-methylmorpholin-4-yl)-1,3-benzothiazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-methylmorpholin-4-yl)-1,3-benzothiazol-4-amine?
The IUPAC name of 5-(2-methylmorpholin-4-yl)-1,3-benzothiazol-4-amine (CID 43451171) is 5-(2-methylmorpholin-4-yl)-1,3-benzothiazol-4-amine.
What is the SMILES notation for 5-(2-methylmorpholin-4-yl)-1,3-benzothiazol-4-amine?
The canonical SMILES for 5-(2-methylmorpholin-4-yl)-1,3-benzothiazol-4-amine is CC1CN(c2ccc3scnc3c2N)CCO1.
What is the InChIKey of 5-(2-methylmorpholin-4-yl)-1,3-benzothiazol-4-amine?
The InChIKey is HAHBMEXDNLMLLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3OS/c1-8-6-15(4-5-16-8)9-2-3-10-12(11(9)13)14-7-17-10/h2-3,7-8H,4-6,13H2,1H3.
What are the key properties of 5-(2-methylmorpholin-4-yl)-1,3-benzothiazol-4-amine?
5-(2-methylmorpholin-4-yl)-1,3-benzothiazol-4-amine has a molecular weight of 249.34 g/mol, XLogP of 2.10, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-methylmorpholin-4-yl)-1,3-benzothiazol-4-amine is sourced from PubChem (CID 43451171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).