C12H14N4O2S — CID 83101060
4-(4-amino-1,3-benzothiazol-5-yl)morpholine-3-carboxamide (PubChem CID 83101060) has the molecular formula C12H14N4O2S and a molecular weight of 278.34 g/mol. Its IUPAC name is 4-(4-amino-1,3-benzothiazol-5-yl)morpholine-3-carboxamide.
| Compound Name | 4-(4-amino-1,3-benzothiazol-5-yl)morpholine-3-carboxamide |
|---|---|
| PubChem CID | 83101060 |
| Molecular Formula | C12H14N4O2S |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 4-(4-amino-1,3-benzothiazol-5-yl)morpholine-3-carboxamide |
| SMILES | NC(=O)C1COCCN1c1ccc2scnc2c1N |
| InChI | InChI=1S/C12H14N4O2S/c13-10-7(1-2-9-11(10)15-6-19-9)16-3-4-18-5-8(16)12(14)17/h1-2,6,8H,3-5,13H2,(H2,14,17) |
| InChIKey | UKXPVWIKLZNOLM-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|