C15H15N3S — CID 43451362
5-N-(3-ethylphenyl)-1,3-benzothiazole-4,5-diamine (PubChem CID 43451362) has the molecular formula C15H15N3S and a molecular weight of 269.37 g/mol. Its IUPAC name is 5-N-(3-ethylphenyl)-1,3-benzothiazole-4,5-diamine.
| Compound Name | 5-N-(3-ethylphenyl)-1,3-benzothiazole-4,5-diamine |
|---|---|
| PubChem CID | 43451362 |
| Molecular Formula | C15H15N3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 5-N-(3-ethylphenyl)-1,3-benzothiazole-4,5-diamine |
| SMILES | CCc1cccc(Nc2ccc3scnc3c2N)c1 |
| InChI | InChI=1S/C15H15N3S/c1-2-10-4-3-5-11(8-10)18-12-6-7-13-15(14(12)16)17-9-19-13/h3-9,18H,2,16H2,1H3 |
| InChIKey | URNGQGQKNKZMGY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|