C14H12BrN3S — CID 82761384
5-N-(2-bromo-5-methylphenyl)-1,3-benzothiazole-4,5-diamine (PubChem CID 82761384) has the molecular formula C14H12BrN3S and a molecular weight of 334.24 g/mol. Its IUPAC name is 5-N-(2-bromo-5-methylphenyl)-1,3-benzothiazole-4,5-diamine.
| Compound Name | 5-N-(2-bromo-5-methylphenyl)-1,3-benzothiazole-4,5-diamine |
|---|---|
| PubChem CID | 82761384 |
| Molecular Formula | C14H12BrN3S |
| Molecular Weight | 334.24 g/mol |
| Exact Mass | 332.99 |
| IUPAC Name | 5-N-(2-bromo-5-methylphenyl)-1,3-benzothiazole-4,5-diamine |
| SMILES | Cc1ccc(Br)c(Nc2ccc3scnc3c2N)c1 |
| InChI | InChI=1S/C14H12BrN3S/c1-8-2-3-9(15)11(6-8)18-10-4-5-12-14(13(10)16)17-7-19-12/h2-7,18H,16H2,1H3 |
| InChIKey | MCKNQKHYDLCCOS-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.24 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|