C13H10ClN3S — CID 43383093
5-N-(2-chlorophenyl)-1,3-benzothiazole-4,5-diamine (PubChem CID 43383093) has the molecular formula C13H10ClN3S and a molecular weight of 275.76 g/mol. Its IUPAC name is 5-N-(2-chlorophenyl)-1,3-benzothiazole-4,5-diamine.
| Compound Name | 5-N-(2-chlorophenyl)-1,3-benzothiazole-4,5-diamine |
|---|---|
| PubChem CID | 43383093 |
| Molecular Formula | C13H10ClN3S |
| Molecular Weight | 275.76 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 5-N-(2-chlorophenyl)-1,3-benzothiazole-4,5-diamine |
| SMILES | Nc1c(Nc2ccccc2Cl)ccc2scnc12 |
| InChI | InChI=1S/C13H10ClN3S/c14-8-3-1-2-4-9(8)17-10-5-6-11-13(12(10)15)16-7-18-11/h1-7,17H,15H2 |
| InChIKey | LVJBWQMONFKITF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.76 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|