C13H9ClFN3S — CID 43451375
5-N-(3-chloro-4-fluorophenyl)-1,3-benzothiazole-4,5-diamine (PubChem CID 43451375) has the molecular formula C13H9ClFN3S and a molecular weight of 293.75 g/mol. Its IUPAC name is 5-N-(3-chloro-4-fluorophenyl)-1,3-benzothiazole-4,5-diamine.
| Compound Name | 5-N-(3-chloro-4-fluorophenyl)-1,3-benzothiazole-4,5-diamine |
|---|---|
| PubChem CID | 43451375 |
| Molecular Formula | C13H9ClFN3S |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | 5-N-(3-chloro-4-fluorophenyl)-1,3-benzothiazole-4,5-diamine |
| SMILES | Nc1c(Nc2ccc(F)c(Cl)c2)ccc2scnc12 |
| InChI | InChI=1S/C13H9ClFN3S/c14-8-5-7(1-2-9(8)15)18-10-3-4-11-13(12(10)16)17-6-19-11/h1-6,18H,16H2 |
| InChIKey | OZGHKHCOIFSLJT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|