C10H12N4OS — CID 43451444
2-[(4-amino-1,3-benzothiazol-5-yl)-methylamino]acetamide (PubChem CID 43451444) has the molecular formula C10H12N4OS and a molecular weight of 236.30 g/mol. Its IUPAC name is 2-[(4-amino-1,3-benzothiazol-5-yl)-methylamino]acetamide.
| Compound Name | 2-[(4-amino-1,3-benzothiazol-5-yl)-methylamino]acetamide |
|---|---|
| PubChem CID | 43451444 |
| Molecular Formula | C10H12N4OS |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 2-[(4-amino-1,3-benzothiazol-5-yl)-methylamino]acetamide |
| SMILES | CN(CC(N)=O)c1ccc2scnc2c1N |
| InChI | InChI=1S/C10H12N4OS/c1-14(4-8(11)15)6-2-3-7-10(9(6)12)13-5-16-7/h2-3,5H,4,12H2,1H3,(H2,11,15) |
| InChIKey | CVBVDLFGADSAGC-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|