C14H9F3N2OS — CID 43451536
5-[3-(trifluoromethyl)phenoxy]-1,3-benzothiazol-4-amine (PubChem CID 43451536) has the molecular formula C14H9F3N2OS and a molecular weight of 310.30 g/mol. Its IUPAC name is 5-[3-(trifluoromethyl)phenoxy]-1,3-benzothiazol-4-amine.
| Compound Name | 5-[3-(trifluoromethyl)phenoxy]-1,3-benzothiazol-4-amine |
|---|---|
| PubChem CID | 43451536 |
| Molecular Formula | C14H9F3N2OS |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 5-[3-(trifluoromethyl)phenoxy]-1,3-benzothiazol-4-amine |
| SMILES | Nc1c(Oc2cccc(C(F)(F)F)c2)ccc2scnc12 |
| InChI | InChI=1S/C14H9F3N2OS/c15-14(16,17)8-2-1-3-9(6-8)20-10-4-5-11-13(12(10)18)19-7-21-11/h1-7H,18H2 |
| InChIKey | OZGXGBDGPCFQNP-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|